Home
Products
Isorhapotogenin
| Product Name | Isorhapotogenin |
| Price: | $190 / 10mg |
| Catalog No.: | CN03872 |
| CAS No.: | 32507-66-7 |
| Molecular Formula: | C15H14O4 |
| Molecular Weight: | 258.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Gnetum montanum Markgr. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(/C=C/c2cc(O)cc(c2)O)ccc1O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isorhapontigenin, an orally bioavailable dietary polyphenol isolated from the Chinese herb Gnetum cleistostachyum, displays anti-inflammatory effects. Isorhapontigenin induces autophagy and inhibits invasive bladder cancer formation[1][2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 471.8±35.0 °C at 760 mmHg |
| Flash Point | 239.1±25.9 °C |
| Exact Mass | 258.089203 |
| PSA | 69.92000 |
| LogP | 2.90 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Storage condition | room temp |