Home
Products
Periplocymarin
| Product Name | Periplocymarin |
| Price: | $219 / 10mg |
| Catalog No.: | CN02322 |
| CAS No.: | 32476-67-8 |
| Molecular Formula: | C30H46O8 |
| Molecular Weight: | 534.69 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The root barks of Periploca sepium Bunge |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CO[C@H]1C[C@H](O[C@H]2CC[C@]3([C@](C2)(O)CC[C@@H]2[C@@H]3CC[C@]3([C@]2(O)CC[C@@H]3C2=CC(=O)OC2)C)C)O[C@@H]([C@H]1O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Periplocymarin, a cardiac glycoside isolated from Periploca sepium and Periploca graeca, is a potential anti-cancer compound[1][2]. |
| In Vitro | Periplocymarin inhibits proliferation of PC3, U937, HCT-8, Bel-7402, BGC823, A549, and A2780 cell lines in vitro with IC50 values of 0.02-0.29 µM[2]. |
| Density | 1.27±0.1 g/cm3 (20 ºC 760 Torr) |
| Boiling Point | 690.9±55.0℃ at 760 mmHg |
| Exact Mass | 534.31900 |
| PSA | 114.68000 |
| LogP | 3.25430 |