Home
Products
Quercetin 3-O-neohesperidoside
| Product Name | Quercetin 3-O-neohesperidoside |
| Price: | $439 / 5mg |
| Catalog No.: | CN04431 |
| CAS No.: | 32453-36-4 |
| Molecular Formula: | C27H30O16 |
| Molecular Weight: | 610.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Callicarpa bodinieri |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2c(oc3c(c2=O)c(O)cc(c3)O)c2ccc(c(c2)O)O)[C@@H]([C@H]([C@H]1O)O)O[C@@H]1O[C@@H](C)[C@H]([C@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Quercetin 3-O-neohesperidoside, a flavonoid glycoside, has anti-inflammatory activity[1]. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 987.1±65.0 °C at 760 mmHg |
| Flash Point | 326.7±27.8 °C |
| Exact Mass | 610.153381 |
| LogP | 2.45 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8℃ |