Home
Products
Isofebrifugine
| Product Name | Isofebrifugine |
| Price: | $204 / 10mg |
| Catalog No.: | CN01250 |
| CAS No.: | 32434-44-9 |
| Molecular Formula: | C16H19N3O3 |
| Molecular Weight: | 301.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Dichroa febrifuga |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=c1n(cnc2c1cccc2)CC1(O)C[C@H]2[C@@H](O1)CCCN2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isofebrifugine, isolated from a Chinese medicinal plant, Chang Shan (Dichroa febrifuga), is a natural quinazolinone alkaloid with important physiological activities and good pharmacological effects. Antimalarial effect[1]. |
| Density | 1.48±0.1 g/cm3 (20 ºC 760 Torr) |
| Boiling Point | 519.8±58.0 °C(Predicted) |
| Exact Mass | 301.14300 |
| PSA | 76.38000 |
| LogP | 0.95480 |