Home
Products
Pilloin
| Product Name | Pilloin |
| Price: | $321 / 10mg |
| Catalog No.: | CN04732 |
| CAS No.: | 32174-62-2 |
| Molecular Formula: | C17H14O6 |
| Molecular Weight: | 314.29 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Marrubium cylleneum. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c2c(c1)oc(cc2=O)c1ccc(c(c1)O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pilloin, a flavonoid isolated from Marrubium cylleneum, exerts a cytotoxic action targeted at the transformed lymphoblasts. Pilloin also possesses anti-inflammatory activity[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 569.6±50.0 °C at 760 mmHg |
| Flash Point | 213.9±23.6 °C |
| Exact Mass | 314.079041 |
| PSA | 89.13000 |
| LogP | 3.35 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |