Home
Products
3-Deoxyaconitine
| Product Name | 3-Deoxyaconitine |
| Price: | Inquiry |
| Catalog No.: | CN01088 |
| CAS No.: | 3175-95-9 |
| Molecular Formula: | C34H47NO10 |
| Molecular Weight: | 629.74 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Aconitum kusnezoffii Reichb. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC[C@]12CC[C@@H]([C@@]34[C@@H]2[C@@H](OC)[C@@H](C3N(C1)CC)[C@@]1([C@@H]2[C@H]4C[C@@]([C@@H]2OC(=O)c2ccccc2)([C@H]([C@@H]1O)OC)O)OC(=O)C)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3-Deoxyaconitine is a diterpenoid alkaloid, isolated from Aconitum Carmichaeli Debx.[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 680.6±55.0 °C at 760 mmHg |
| Flash Point | 365.4±31.5 °C |
| Exact Mass | 629.320007 |
| PSA | 133.22000 |
| LogP | 1.45 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |