Home
Products
Hesperetin 7-O-glucoside
| Product Name | Hesperetin 7-O-glucoside |
| Price: | $92 / 5mg |
| Catalog No.: | CN05412 |
| CAS No.: | 31712-49-9 |
| Molecular Formula: | C22H24O11 |
| Molecular Weight: | 464.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Mentha aquatica |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc3O[C@@H](CC(=O)c3c(c2)O)c2ccc(c(c2)O)OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hesperetin 7-O-glucoside is produced by the enzymatic conversion of Hesperidin. Hesperetin 7-O-glucoside is a potent human HMG-CoA reductase inhibitor and also effectively inhibits the growth of Helicobacter pylori. Antihypertensive effect[1][2]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 807.1±65.0 °C at 760 mmHg |
| Flash Point | 282.0±27.8 °C |
| Exact Mass | 464.131866 |
| PSA | 175.37000 |
| LogP | 0.52 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |