Home
Products
Isobavachin
| Product Name | Isobavachin |
| Price: | $204 / 20mg |
| Catalog No.: | CN05414 |
| CAS No.: | 31524-62-6 |
| Molecular Formula: | C20H20O4 |
| Molecular Weight: | 324.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Psoralea corylifolia L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1c(O)ccc2c1O[C@@H](CC2=O)c1ccc(cc1)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isobavachin, an antioxidant isaolated from Psoralea morisiana with a prenyl group at position 8 of ring A, promotes neuronal differentiation and the potential role of its protein prenylation[1][2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 558.3±50.0 °C at 760 mmHg |
| Flash Point | 202.1±23.6 °C |
| Exact Mass | 324.136169 |
| PSA | 66.76000 |
| LogP | 4.85 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Storage condition | 2-8C |