Home
Products
Panasenoside
| Product Name | Panasenoside |
| Price: | $409 / 10mg |
| Catalog No.: | CN04518 |
| CAS No.: | 31512-06-8 |
| Molecular Formula: | C27H30O16 |
| Molecular Weight: | 610.52 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Lilium pumilum D. C. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2c(oc3c(c2=O)c(O)cc(c3)O)c2ccc(cc2)O)[C@@H]([C@H]([C@H]1O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Panasenoside is a flavonoid isolated from Lilium pumilum D. C. Panasenoside exhibits α-glucosidase inhibitory activity[1]. |
| Target | IC50: α-glucosidase[1] |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 995.0±65.0 °C at 760 mmHg |
| Flash Point | 329.3±27.8 °C |
| Exact Mass | 610.153381 |
| LogP | -0.58 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |