Home
Products
gamma-Mangostin
| Product Name | gamma-Mangostin |
| Price: | $117 / 20mg |
| Catalog No.: | CN05829 |
| CAS No.: | 31271-07-5 |
| Molecular Formula: | C23H24O6 |
| Molecular Weight: | 396.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Yellow powder |
| Source: | The fruits of Garcinia mangostana |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1c(O)cc2c(c1O)c(=O)c1c(o2)cc(c(c1CC=C(C)C)O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Gamma-Mangostin is a novel competitive 5-hydroxytryptamine 2A (5-HT2A) receptors antagonist, purified from the fruit hull of the medicinal plant Garcinia mangostana. Gamma-Mangostin is a inhibitor of Transthyretin (TTR) fibrillization, it binds to the thyroxine (T4)-binding sites and stabilized the TTR tetramer[2]. Gamma-Mangostin inhibits [3H] spiperone binding to cultured rat aortic myocytes (IC50=3.5 nM) and reduces The perfusion pressure response of rat coronary artery to 5-HT2A (IC50=0.32 µM) [1]. |
| Target | 5-hydroxytryptamine 2A (5-HT2A) receptors[1] |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 648.4±55.0 °C at 760 mmHg |
| Flash Point | 226.4±25.0 °C |
| Exact Mass | 396.157288 |
| PSA | 111.13000 |
| LogP | 5.14 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Storage condition | 2-8°C |