Home
Products
2'-Deoxyguanosine
| Product Name | 2'-Deoxyguanosine |
| Price: | Inquiry |
| Catalog No.: | CN00021 |
| CAS No.: | 312693-72-4 |
| Molecular Formula: | C10H13N5O4 |
| Molecular Weight: | 267.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The peels of Punica granatum L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H](C[C@@H]1O)n1cnc2c1[nH]c(=N)[nH]c2=O.O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Boiling Point | 801.4ºC at 760 mmHg |
| Flash Point | 438.5ºC |
| Exact Mass | 267.09700 |
| PSA | 139.28000 |
| Storage condition | 2-8°C |