Home
Products
Eucalyptin
| Product Name | Eucalyptin |
| Price: | Inquiry |
| Catalog No.: | CN05415 |
| CAS No.: | 3122-88-1 |
| Molecular Formula: | C19H18O5 |
| Molecular Weight: | 326.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The branches of Eucalyptus globulus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)c1cc(=O)c2c(o1)c(C)c(c(c2O)C)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Eucalyptin is a flavonoid. Eucalyptin can be isolated from Myrcia citrifolia[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 539.5±50.0 °C at 760 mmHg |
| Flash Point | 196.4±23.6 °C |
| Exact Mass | 326.115417 |
| PSA | 68.90000 |
| LogP | 4.32 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |