Home
Products
3-Methyl-4-nitrobenzoic acid
| Product Name | 3-Methyl-4-nitrobenzoic acid |
| Price: | Inquiry |
| Catalog No.: | CN01716 |
| CAS No.: | 3113-71-1 |
| Molecular Formula: | C8H7NO4 |
| Molecular Weight: | 181.15 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Styrax tonkinensis |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC(=O)c1ccc(c(c1)C)[N+](=O)[O-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 356.0±30.0 °C at 760 mmHg |
| Flash Point | 161.2±13.0 °C |
| Exact Mass | 181.037506 |
| PSA | 83.12000 |
| LogP | 2.35 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |