Home
Products
Taxifolin 3'-O-glucoside
| Product Name | Taxifolin 3'-O-glucoside |
| Price: | Inquiry |
| Catalog No.: | CN04741 |
| CAS No.: | 31106-05-5 |
| Molecular Formula: | C21H22O12 |
| Molecular Weight: | 342.29 g/mol |
| Purity: | >95% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Chamaecyparis obtuse |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(Oc2cc(ccc2O)C2Oc3cc(O)cc(c3C(=O)C2O)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Exact Mass | 466.11100 |
| PSA | 206.60000 |