Home
Products
Decylic acid vanillylamide
| Product Name | Decylic acid vanillylamide |
| Price: | $263 / 5mg |
| Catalog No.: | CN00835 |
| CAS No.: | 31078-36-1 |
| Molecular Formula: | C18H29NO3 |
| Molecular Weight: | 307.43 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The fruits of Capsicum annuum L. var. annuum. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCCCCCCCC(=O)NCc1ccc(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | N-Vanillyldecanamide, a capsaicinoid isolated from the fruits of Capsicum annuum, significantly reduced the radical length of Lactuca sativa seedling in a dose-dependent manner[1]. |
| In Vivo | 辣椒素 |
| Density | 1.027g/cm3 |
| Boiling Point | 502.9ºC at 760mmHg |
| Flash Point | 257.9ºC |
| Exact Mass | 307.21500 |
| PSA | 58.56000 |
| LogP | 4.54860 |