Home
Products
7-O-Methylmangiferin
| Product Name | 7-O-Methylmangiferin |
| Price: | $219 / 20mg |
| Catalog No.: | CN05779 |
| CAS No.: | 31002-12-7 |
| Molecular Formula: | C20H20O11 |
| Molecular Weight: | 436.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Powder |
| Source: | The roots of Polygala tenuifolia. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)c1c(O)cc2c(c1O)c(=O)c1c(o2)cc(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 7-O-Methylmangifer is isolated from the cortexes of Polygala tenuifolia[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 828.6±65.0 °C at 760 mmHg |
| Flash Point | 295.6±27.8 °C |
| Exact Mass | 436.100555 |
| PSA | 190.28000 |
| LogP | 0.43 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Storage condition | -20℃ |