Home
Products
Aloesin
| Product Name | Aloesin |
| Price: | $92 / 20mg |
| Catalog No.: | CN04238 |
| CAS No.: | 30861-27-9 |
| Molecular Formula: | C19H22O9 |
| Molecular Weight: | 394.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Aloe arborescens Mill. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)c1c(O)cc(c2c1oc(CC(=O)C)cc2=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Aloesin (Aloeresin) is an active constituent of the herb aloe vera and displays anti-inflammatory activity, ultraviolet protection, and antibacterium effects. Aloesin exerts its anticancer effect through the MAPK signaling pathway[1][2]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 628.0±55.0 °C at 760 mmHg |
| Flash Point | 224.2±25.0 °C |
| Exact Mass | 394.126373 |
| PSA | 157.66000 |
| LogP | 0.64 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Storage condition | -20℃ |