Home
Products
Cycloolivil
| Product Name | Cycloolivil |
| Price: | $409 / 5mg |
| Catalog No.: | CN02806 |
| CAS No.: | 3064-05-9 |
| Molecular Formula: | C20H24O7 |
| Molecular Weight: | 376.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The herbs of Maytenus hookeri Loes. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2C[C@@](O)(CO)[C@@H]([C@H](c2cc1O)c1ccc(c(c1)OC)O)CO |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cycloolivil (Isoolivil) is a natural polyphenolic compound with a significant radical scavenging activity present in olive tree. Antioxidant and Antiaggregant effects[1]. |
| In Vitro | Cycloolivil is a natural oxygen radical scavengers that reduce thrombin-induced protein tyrosine phosphorylation, Ca2+ signalling and platelet aggregation[1]. |
| Density | 1.354±0.06 g/cm3 |
| Boiling Point | 623.7±55.0 °C at 760 mmHg |
| Flash Point | 331.0±31.5 °C |
| Exact Mass | 376.152191 |
| PSA | 119.61000 |
| LogP | 0.95 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Storage condition | ?20°C |