Home
Products
5'-Demethylaquillochin
| Product Name | 5'-Demethylaquillochin |
| Price: | Inquiry |
| Catalog No.: | CN06273 |
| CAS No.: | 305364-91-4 |
| Molecular Formula: | C20H18O9 |
| Molecular Weight: | 402.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Mallotus apelta |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@H]1Oc2c(O[C@@H]1c1cc(O)c(c(c1)OC)O)c(OC)cc1c2oc(=O)cc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 680.2±55.0 °C at 760 mmHg |
| Flash Point | 245.3±25.0 °C |
| Exact Mass | 402.095093 |
| PSA | 127.82000 |
| LogP | 0.95 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |