Home
Products
L-carnosine
| Product Name | L-carnosine |
| Price: | Inquiry |
| Catalog No.: | CN01050 |
| CAS No.: | 305-84-0 |
| Molecular Formula: | C9H14N4O3 |
| Molecular Weight: | 226.23 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Geranium wilfordii Maxim. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | NCCC(=O)N[C@H](C(=O)O)Cc1nc[nH]c1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | L-Carnosine is a dipeptide of the amino acids beta-alanine and histidine and has the potential to suppress many of the biochemical changes that accompany aging. |
| Target | Human Endogenous Metabolite |
| In Vitro | L-Carnosine is a dipeptide of the amino acids beta-alanine and histidine and has the potential to suppress many of the biochemical changes that accompany aging[1]. Carnosine also exhibits some antioxidant effects. The antioxidant mechanism of carnosine is attributed to its chelating effect against metal ions, superoxide dismutase (SOD)-like activity, and ROS and free radicals scavenging ability[2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 656.2±55.0 °C at 760 mmHg |
| Flash Point | 350.7±31.5 °C |
| Exact Mass | 226.106583 |
| PSA | 121.10000 |
| LogP | -2.17 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |