Home
Products
Mearnsitrin
| Product Name | Mearnsitrin |
| Price: | Inquiry |
| Catalog No.: | CN05418 |
| CAS No.: | 30484-88-9 |
| Molecular Formula: | C22H22O12 |
| Molecular Weight: | 478.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The barks of Clausena excavata |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1c(O)cc(cc1O)c1oc2cc(O)cc(c2c(=O)c1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Exact Mass | 478.11100 |
| PSA | 199.51000 |
| LogP | 0.49730 |
| Storage condition | ?20°C |