Home
Products
1-Hydroxybaccatin I
| Product Name | 1-Hydroxybaccatin I |
| Price: | $146 / 20mg |
| Catalog No.: | CN08851 |
| CAS No.: | 30244-37-2 |
| Molecular Formula: | C32H44O14 |
| Molecular Weight: | 652.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Cryst. |
| Source: | The barks of Taxus chinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@H]1C[C@@]2(O)[C@@H](OC(=O)C)[C@@H]3[C@@]4(CO4)[C@@H](OC(=O)C)C[C@@H]([C@]3([C@H]([C@@H](C(=C1C)C2(C)C)OC(=O)C)OC(=O)C)C)OC(=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 657.2±55.0 °C at 760 mmHg |
| Flash Point | 197.6±25.0 °C |
| Exact Mass | 652.273132 |
| PSA | 190.56000 |
| LogP | 2.15 |
| Vapour Pressure | 0.0±4.5 mmHg at 25°C |