Home
Products
Effusanin A
| Product Name | Effusanin A |
| Price: | Inquiry |
| Catalog No.: | CN08852 |
| CAS No.: | 30220-43-0 |
| Molecular Formula: | C20H28O5 |
| Molecular Weight: | 348.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Rabdosia rubescens |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C1[C@@H]2CC[C@@H]3[C@](C1=O)(C2)[C@]1(O)OC[C@@]23[C@@H](O)CCC([C@H]2[C@@H]1O)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Effusanin A is a natural product that can be found in Isodon rugosus. Effusanin A exhibits DNA-damaging and antibacterial activities[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 546.3±50.0 °C at 760 mmHg |
| Flash Point | 195.0±23.6 °C |
| Exact Mass | 348.193665 |
| PSA | 86.99000 |
| LogP | 1.88 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |