Home
Products
Desoxyrhaponticin
| Product Name | Desoxyrhaponticin |
| Price: | $143 / 10mg |
| Catalog No.: | CN03736 |
| CAS No.: | 30197-14-9 |
| Molecular Formula: | C21H24O8 |
| Molecular Weight: | 404.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The roots of Rumex obtusifolius L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(/C=C/c3ccc(cc3)OC)cc(c2)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Desoxyrhaponticin is a stilbene glycoside from the Tibetan nutritional food Rheum tanguticum Maxim. Desoxyrhaponticin is a Fatty acid synthase (FAS) inhibitor, and has apoptotic effect on human cancer cells[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 700.5±60.0 °C at 760 mmHg |
| Flash Point | 377.5±32.9 °C |
| Exact Mass | 404.147125 |
| PSA | 128.84000 |
| LogP | 1.48 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Storage condition | 2-8°C |