Home
Products
Robinin
| Product Name | Robinin |
| Price: | $263 / 5mg |
| Catalog No.: | CN05419 |
| CAS No.: | 301-19-9 |
| Molecular Formula: | C33H40O19 |
| Molecular Weight: | 740.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The barks of Rauvolfia yunnanensis Tsiang |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1ccc(cc1)c1oc2cc(OC3OC(C)C(C(C3O)O)O)cc(c2c(=O)c1OC1OC(COC2OC(C)C(C(C2O)O)O)C(C(C1O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Robinin is present in flavonoid fraction of Vigna unguiculata leaf. Robinin inhibits upregulated expression of TLR2 and TLR4. Robinin ameliorates oxidized low density lipoprotein (Ox-LDL) induced inflammatory insult through TLR4/NF-κB pathway[1]. |
| Target | TLR2 TLR4 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 1064.4±65.0 °C at 760 mmHg |
| Flash Point | 335.7±27.8 °C |
| Exact Mass | 740.216370 |
| PSA | 308.12000 |
| LogP | 0.89 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | ?20°C |