Home
Products
Shanzhiside
| Product Name | Shanzhiside |
| Price: | $424 / 10mg |
| Catalog No.: | CN03152 |
| CAS No.: | 29836-27-9 |
| Molecular Formula: | C16H24O11 |
| Molecular Weight: | 392.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Lamiophlomis rotata (Benth.) Kudo. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2OC=C([C@@H]3[C@H]2[C@@](C)(O)C[C@H]3O)C(=O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Shanziside is a iridoid glucoside isolated from Phlomis tuberosa L[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 692.3±55.0 °C at 760 mmHg |
| Flash Point | 251.6±25.0 °C |
| Exact Mass | 392.131866 |
| PSA | 186.37000 |
| LogP | -3.01 |
| Vapour Pressure | 0.0±4.9 mmHg at 25°C |