Home
Products
Desmethylbellidifolin
| Product Name | Desmethylbellidifolin |
| Price: | $366 / 10mg |
| Catalog No.: | CN05778 |
| CAS No.: | 2980-32-7 |
| Molecular Formula: | C13H8O6 |
| Molecular Weight: | 260.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Powder |
| Source: | The herbs of Gentiana bellidifolia |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc(O)c2c(c1)oc1c(c2=O)c(O)ccc1O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 1,3,5,8-Tetrahydroxyxanthone (Desmethylbellidifolin) is a natural xanthone extracted from Gentianella acuta. 1,3,5,8-Tetrahydroxyxanthone has antispasmodic effect and anti-inflammatory activity[1]. |
| In Vitro | 1,3,5,8-Tetrahydroxyxanthone (Desmethylbellidifolin) attenuates lipopolysaccharide-induced nitric oxide release and proinflammatory cytokine expression in RAW264.7 cells[1]. |
| In Vivo | 1,3,5,8-Tetrahydroxyxanthone (Desmethylbellidifolin; orally; 5, 10, 20 mg/kg; 12 days) can inhibit trinitrobenzenesulfonic acid (TNBS)-induced ulcerative colitis (UC), reducing inflammatory response and alleviate colon muscle spasm[1]. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 605.6±55.0 °C at 760 mmHg |
| Flash Point | 242.0±25.0 °C |
| Exact Mass | 260.032074 |
| PSA | 111.13000 |
| LogP | 0.33 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |