Home
Products
Luteolin-7-O-glucuronide
| Product Name | Luteolin-7-O-glucuronide |
| Price: | $117 / 10mg |
| Catalog No.: | CN05399 |
| CAS No.: | 29741-10-4 |
| Molecular Formula: | C21H18O12 |
| Molecular Weight: | 462.36 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Marchantia berteroana |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC(=O)[C@H]1O[C@@H](Oc2cc(O)c3c(c2)oc(cc3=O)c2ccc(c(c2)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Luteolin 7-O-glucuronide could inhibit Matrix Metalloproteinases (MMP) activities, with IC50s of 17.63, 7.99, 11.42, 12.85, 0.03 μM for MMP-1, MMP-3, MMP-8, MMP-9, MMP-13, respectively. |
| Target | MMP-1:17.63 μM (IC50) MMP-3:7.99 μM (IC50) MMP-8:11.42 μM (IC50) MMP-9:12.85 μM (IC50) MMP13:0.03 μM (IC50) |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 892.5±65.0 °C at 760 mmHg |
| Flash Point | 315.2±27.8 °C |
| Exact Mass | 462.079834 |
| PSA | 207.35000 |
| LogP | -0.25 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | ?20°C |