Home
Products
Sakuranetin
| Product Name | Sakuranetin |
| Price: | $103 / 10mg |
| Catalog No.: | CN05423 |
| CAS No.: | 2957-21-3 |
| Molecular Formula: | C16H14O5 |
| Molecular Weight: | 286.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Oryza sativa L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2O[C@@H](CC(=O)c2c(c1)O)c1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sakuranetin is a rice flavonoid phytoalexin, shows strong antifungal activity[1]. Sakuranetin has anti-inflammatory and antioxidative activities. Sakuranetin ameliorates LPS-induced acute lung injury[2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 555.9±50.0 °C at 760 mmHg |
| Flash Point | 212.4±23.6 °C |
| Exact Mass | 286.084137 |
| PSA | 75.99000 |
| LogP | 3.37 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Storage condition | 2-8℃ |