Home
Products
(E)-N-Caffeoylputrescine
| Product Name | (E)-N-Caffeoylputrescine |
| Price: | $380 / 5mg |
| Catalog No.: | CN00733 |
| CAS No.: | 29554-26-5 |
| Molecular Formula: | C13H18N2O3 |
| Molecular Weight: | 250.29 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Exochorda racemosa |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | NCCCCNC(=O)C=Cc1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | N-Caffeoylputrescine,(E)- is a caffeic acid amide found in the tobacco plants (Nicotiana tabacum L.)[1]. |
| Density | 1.233±0.06 g/cm3 |
| Boiling Point | 545.5±50.0 °C at 760 mmHg |
| Flash Point | 283.7±30.1 °C |
| Exact Mass | 250.131744 |
| PSA | 99.07000 |
| LogP | 0.41 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |