Home
Products
Sophorabioside
| Product Name | Sophorabioside |
| Price: | $293 / 5mg |
| Catalog No.: | CN04631 |
| CAS No.: | 2945-88-2 |
| Molecular Formula: | C27H30O14 |
| Molecular Weight: | 578.52 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Sophora japonica. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(Oc2ccc(cc2)c2coc3c(c2=O)c(O)cc(c3)O)C(C(C1O)O)OC1OC(C)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sophorabioside is a flavonoid-glycoside isolated from Sophora japonica[1]. |
| Exact Mass | 578.16400 |
| PSA | 228.97000 |