Home
Products
4',7-Di-O-methylnaringenin
| Product Name | 4',7-Di-O-methylnaringenin |
| Price: | $351 / 10mg |
| Catalog No.: | CN05424 |
| CAS No.: | 29424-96-2 |
| Molecular Formula: | C17H16O5 |
| Molecular Weight: | 300.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Aglaia odorata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)[C@@H]1CC(=O)c2c(O1)cc(cc2O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 4',7-Di-O-methylnaringenin is a flavonoid found in Renealmia alpinia[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 524.4±50.0 °C at 760 mmHg |
| Flash Point | 196.0±23.6 °C |
| Exact Mass | 300.099762 |
| PSA | 64.99000 |
| LogP | 4.02 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Storage condition | ?20°C |