Home
Products
Secoisolariciresinol
| Product Name | Secoisolariciresinol |
| Price: | $234 / 5mg |
| Catalog No.: | CN02951 |
| CAS No.: | 29388-59-8 |
| Molecular Formula: | C20H26O6 |
| Molecular Weight: | 362.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The heartwoods of Podocarpus spicata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@@H]([C@@H](Cc1ccc(c(c1)OC)O)CO)Cc1ccc(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Secoisolariciresinol, isolated from water extract of silver fir (Abies alba) wood, is a lignan, a type of phenylpropanoids. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 609.1±55.0 °C at 760 mmHg |
| Flash Point | 322.1±31.5 °C |
| Exact Mass | 362.172943 |
| PSA | 99.38000 |
| LogP | 0.98 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Storage condition | 2-8℃ |