Home
Products
Deoxyelephantopin
| Product Name | Deoxyelephantopin |
| Price: | $351 / 5mg |
| Catalog No.: | CN09357 |
| CAS No.: | 29307-03-7 |
| Molecular Formula: | C19H20O6 |
| Molecular Weight: | 344.36 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Elephantopus scaber Linn. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC1=C[C@H]2OC(=O)C(=C)[C@@H]2[C@H](CC2=C[C@@H](C1)OC2=O)OC(=O)C(=C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Deoxyelephantopin, a natural bioactive sesquiterpene lactone from Elephantopus scaber, has shown promising anticancer effects against a broad spectrum of cancers. Deoxyelephantopin inhibits NF-κB, MAPK, PI3K/Akt, and β-catenin signaling[1]. |
| Target | NF-κB |
| In Vitro | Deoxyelephantopin inhibits the cell growth of HCT 116 (colorectal), K562 (chronic myeloid leukemia), KB (oral), and T47D (breast) cancer cell lines with IC50s of 7.46, 4.02, 3.35, 1.86 μg/mL, respectively[1]. Deoxyelephantopin increases the expression of p53, p-JNK, and p-p38 and decreases the expression of p-STAT3 and p-mTOR in cancer cells. Deoxyelephantopin downregulates MMP-2 and MMP-9, uPA, and uPAR mRNA levels in cancer cells[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 584.3±50.0 °C at 760 mmHg |
| Flash Point | 258.1±30.2 °C |
| Exact Mass | 344.125977 |
| PSA | 78.90000 |
| LogP | 1.51 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |