Home
Products
Dehydrotrametenolic acid
| Product Name | Dehydrotrametenolic acid |
| Price: | $54 / 5mg |
| Catalog No.: | CN07571 |
| CAS No.: | 29220-16-4 |
| Molecular Formula: | C30H46O3 |
| Molecular Weight: | 454.69 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Wolfiporia cocos (Schw.) Ryv. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCC(=C)[C@@H]([C@H]1[C@@H](O)C[C@@]2([C@]1(C)CC=C1C2=CC[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)C(=O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3-Dehydrotrametenolic acid, isolated from the sclerotium of Poria cocos, is a lactate dehydrogenase (LDH) inhibitor. 3-Dehydrotrametenolic acid promotes adipocyte differentiation in vitro and acts as an insulin sensitizer in vivo. 3-Dehydrotrametenolic acid induces apoptosis and has anticancer activity[1][2]. |
| Target | Lactate dehydrogenase [1] |
| Density | 1.08±0.1 g/cm3 |
| Boiling Point | 585.4±50.0 °C at 760 mmHg |
| Flash Point | 321.9±26.6 °C |
| Exact Mass | 454.344696 |
| PSA | 57.53000 |
| LogP | 8.50 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |
| Storage condition | 2-8℃ |