Home
Products
Procyanidin B4
| Product Name | Procyanidin B4 |
| Price: | $351 / 5mg |
| Catalog No.: | CN04416 |
| CAS No.: | 29106-51-2 |
| Molecular Formula: | C30H26O12 |
| Molecular Weight: | 578.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Vitis vinifera L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc(O)c2c(c1)O[C@@H]([C@H]([C@@H]2c1c(O)cc(c2c1O[C@@H]([C@@H](C2)O)c1ccc(c(c1)O)O)O)O)c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Procyanidol B4 ((-)-Procyanidin B4) is a flavanol, isolated from Litchi chinensis. Anti-inflammatory properties[1]. |
| Density | 1.705g/cm3 |
| Boiling Point | 955.3ºC at 760 mmHg |
| Flash Point | 531.6ºC |
| Exact Mass | 578.14200 |
| PSA | 220.76000 |
| LogP | 2.99500 |
| Vapour Pressure | 0mmHg at 25°C |
| Storage condition | 2-8℃ |