Home
Products
Pinoresinol dimethyl ether
| Product Name | Pinoresinol dimethyl ether |
| Price: | $146 / 10mg |
| Catalog No.: | CN02768 |
| CAS No.: | 29106-36-3 |
| Molecular Formula: | C22H26O6 |
| Molecular Weight: | 386.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The flowers of Magnolia denudata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(ccc1OC)[C@H]1OC[C@H]2[C@@H]1CO[C@@H]2c1ccc(c(c1)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pinoresinol dimethyl ether ((+)-Eudesmin) is a non-phenolic furofuran lignan isolated from the stem bark of Magnolia kobus with neuritogenic activity. Pinoresinol dimethyl ether ((+)-Eudesmin) can induce neuritis outgrowth from PC12 cells by stimulating up-stream MAPK, PKC and PKA pathways[1][2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 517.3±50.0 °C at 760 mmHg |
| Flash Point | 209.8±30.0 °C |
| Exact Mass | 386.172943 |
| LogP | 3.08 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | -20℃ |