Home
Products
Cimiracemoside D
| Product Name | Cimiracemoside D |
| Price: | $351 / 10mg |
| Catalog No.: | CN07567 |
| CAS No.: | 290821-39-5 |
| Molecular Formula: | C37H58O11 |
| Molecular Weight: | 678.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Cimicifuga foetida L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CC(=O)O[C@@H]1C[C@]23C[C@]43CC[C@@H](C([C@@H]4CC[C@H]2[C@]2([C@@]1(C)[C@H]1[C@H](C)C[C@H]3OC1([C@@H]2O)O[C@@H]3C(O)(C)C)C)(C)C)O[C@@H]1OC[C@@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cimiracemoside D is a natural product found in Actaea racemosa with unknown details. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 773.3±60.0 °C at 760 mmHg |
| Flash Point | 234.7±26.4 °C |
| Exact Mass | 678.397888 |
| PSA | 164.37000 |
| LogP | 5.18 |
| Vapour Pressure | 0.0±6.0 mmHg at 25°C |
| Storage condition | -20°C |