Home
Products
5-Hydroxy-3',4',7-trimethoxyflavone
| Product Name | 5-Hydroxy-3',4',7-trimethoxyflavone |
| Price: | $219 / 10mg |
| Catalog No.: | CN05425 |
| CAS No.: | 29080-58-8 |
| Molecular Formula: | C18H16O6 |
| Molecular Weight: | 328.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Callicarpa bodinieri Levl. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c2c(c1)oc(cc2=O)c1ccc(c(c1)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 7,3',4'-Tri-O-methylluteolin (5-Hydroxy-3',4',7-trimethoxyflavone) is a flavonoid from the herb Lippia nodiflora L. (Verbenaceae) which has been documented to exhibit anti-inflammatory, antipyretic, antitussive, antidiabetic, anticancer, and antimelanogenesis properties. 7,3',4'-Tri-O-methylluteolin obviously reduces the prodn of pro-inflammatory cytokines, such as TNF-α, IL-6, and IL-1β in a concentration-dependent manner. 7,3',4'-Tri-O-methylluteolin significantly induces reduction in the mRNA expressions of inducible nitric oxide synthase and cyclooxygenase-2, representing that inhibition occurs at the transcriptional level[1]. |
| Target | TNF-α IL-6 IL-1β |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 536.3±50.0 °C at 760 mmHg |
| Flash Point | 197.0±23.6 °C |
| Exact Mass | 328.094696 |
| PSA | 78.13000 |
| LogP | 3.22 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |