Home
Products
3',4',5,5',6,7-Hexamethoxyflavone
| Product Name | 3',4',5,5',6,7-Hexamethoxyflavone |
| Price: | Inquiry |
| Catalog No.: | CN04353 |
| CAS No.: | 29043-07-0 |
| Molecular Formula: | C21H22O8 |
| Molecular Weight: | 402.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The peels of Citrus nobilis Lour. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(OC)cc(cc1OC)c1cc(=O)c2c(o1)cc(c(c2OC)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3′,4′,5′,5,6,7-Hexamethoxyflavone is a flavonoid with antiprotozoal activity. 3′,4′,5′,5,6,7-Hexamethoxyflavone inhibits trypanosoma bruceirhodesiense with IC50 of 21.3 μM (8.58 g/mL)[1]. |
| Density | 1.244g/cm3 |
| Boiling Point | 572.8ºC at 760 mmHg |
| Flash Point | 249.9ºC |
| Exact Mass | 402.13100 |
| PSA | 85.59000 |
| LogP | 3.51160 |
| Vapour Pressure | 3.95E-13mmHg at 25°C |