Home
Products
Glucosamine sulfate
| Product Name | Glucosamine sulfate |
| Price: | $15 / 20mg |
| Catalog No.: | CN06728 |
| CAS No.: | 29031-19-4 |
| Molecular Formula: | C6H15NO9S |
| Molecular Weight: | 277.25 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | Present in mucopolysaccharides and in polysaccharides found in bacteria, fungi, higher plants |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OS(=O)(=O)O.OC[C@H]([C@H]([C@@H]([C@H](C=O)N)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Glucosamine sulfate (D-Glucosamine sulfate) is an amino sugar and a prominent precursor in the biochemical synthesis of glycosylated proteins and lipids, is used as a dietary supplement. Glucosamine sulfate also is a natural constituent of glycosaminoglycans in the cartilage matrix and synovial fluid, which when administered exogenously, exerts pharmacological effects on osteoarthritic cartilage and chondrocytes[1]. |
| Target | Human Endogenous Metabolite |
| In Vitro | Glucosamine sulfate (D-Glucosamine sulfate) exhibits dose-dependent DPPH antioxidant activity[2]. Glucosamine sulfate treatment of Short-term (4 h) inhibits HIF-1α at the protein level, decreases phosphorylation of p70S6K and S6, translation-related proteins[3]. Glucosamine sulfate significantly decreases renal expression of α-smooth muscle actin, collagen I, and fibronectin in the obstructed kidneys and TGF-β1-treated renal cells[4]. |
| Density | 1.563g/cm3 |
| Boiling Point | 449.9ºC at 760mmHg |
| Flash Point | 225.9ºC |
| Exact Mass | 277.046753 |
| PSA | 206.99000 |
| Vapour Pressure | 5.53E-10mmHg at 25°C |
| Storage condition | -20?C Freezer |