Home
Products
Lasiodin
| Product Name | Lasiodin |
| Price: | $176 / 5mg |
| Catalog No.: | CN08590 |
| CAS No.: | 28957-08-6 |
| Molecular Formula: | C22H30O7 |
| Molecular Weight: | 406.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Cryst. |
| Source: | The herbs of Isodon japonicus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@H]1CCC([C@@H]2[C@]31CO[C@]([C@H]2O)([C@@]12[C@H]3CC[C@H](C2O)C(=C)C1=O)O)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Lasiokaurin is a diterpenoid compound isolated from Isodon lasiocarpus[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 588.0±50.0 °C at 760 mmHg |
| Flash Point | 203.8±23.6 °C |
| Exact Mass | 406.199158 |
| PSA | 113.29000 |
| LogP | 2.17 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |