Home
Products
Heraclenin
| Product Name | Heraclenin |
| Price: | $190 / 5mg |
| Catalog No.: | CN06277 |
| CAS No.: | 2880-49-1 |
| Molecular Formula: | C16H14O5 |
| Molecular Weight: | 286.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The fruits of Citrus aurantium L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=c1ccc2c(o1)c(OC[C@H]1OC1(C)C)c1c(c2)cco1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Heraclenin, a natural furanocoumarin, isolated from the root parts of the plant Prangos pabularia. Heraclenin significantly inhibits T cell receptor-mediated proliferation in human primary T cells in a concentration-dependent manner by targeting nuclear factor of activated T-cells (NFAT)[1]. |
| Target | NFAT[1] |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 471.4±45.0 °C at 760 mmHg |
| Flash Point | 238.9±28.7 °C |
| Exact Mass | 286.084137 |
| PSA | 65.11000 |
| LogP | 1.67 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |