Home
Products
Nordihydrocapsaicin
| Product Name | Nordihydrocapsaicin |
| Price: | $161 / 5mg |
| Catalog No.: | CN01384 |
| CAS No.: | 28789-35-7 |
| Molecular Formula: | C17H27NO3 |
| Molecular Weight: | 293.40 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The fruits of Capsicum annuum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(CNC(=O)CCCCCC(C)C)ccc1O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Nordihydrocapsaicin is a capsaicinoid analog and congener of capsaicin in chili peppers[1]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 487.0±35.0 °C at 760 mmHg |
| Flash Point | 248.3±25.9 °C |
| Exact Mass | 293.199097 |
| PSA | 58.56000 |
| LogP | 3.24 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | 2-8℃ |