Home
Products
Apigenin 5-O-beta-D-glucopyranoside
| Product Name | Apigenin 5-O-beta-D-glucopyranoside |
| Price: | Inquiry |
| Catalog No.: | CN05428 |
| CAS No.: | 28757-27-9 |
| Molecular Formula: | C21H20O10 |
| Molecular Weight: | 432.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Scutellaria barbata |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(O)cc3c2c(=O)cc(o3)c2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Salipurpin (Apigenin 5-glucoside) is a flavonoid compound isolated from the branches and leaves of Cephalotaxus fortunei, which has certain anti-inflammatory activity[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 814.2±65.0 °C at 760 mmHg |
| Flash Point | 289.7±27.8 °C |
| Exact Mass | 432.105652 |
| PSA | 170.05000 |
| LogP | -0.17 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |