Home
Products
Cyclo(L-Leu-L-Pro)
| Product Name | Cyclo(L-Leu-L-Pro) |
| Price: | Inquiry |
| Catalog No.: | CN00011 |
| CAS No.: | 2873-36-1 |
| Molecular Formula: | C11H18N2O2 |
| Molecular Weight: | 210.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(C[C@@H]1NC(=O)[C@H]2N(C1=O)CCC2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cyclo(L-Leu-L-Pro) is an inhibitory substance targeting to production of norsolorinic acid (NA，a precursor of aflatoxin)，which can be isolated from A. xylosoxidans NFRI-A1. Cyclo(L-Leu-L-Pro) inhibits accumulation of NA by A. parasiticus NFRI-95 and inhibits spore formation. Cyclo(L-Leu-L-Pro) inhibits aflatoxin production with an IC50 of 0.2 mg/mL in A. parasiticus SYS-4[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 427.6±34.0 °C at 760 mmHg |
| Flash Point | 212.4±25.7 °C |
| Exact Mass | 210.136826 |
| PSA | 49.41000 |
| LogP | -0.84 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |