Home
Products
Euphorbiasteroid
| Product Name | Euphorbiasteroid |
| Price: | $77 / 20mg |
| Catalog No.: | CN08514 |
| CAS No.: | 28649-59-4 |
| Molecular Formula: | C32H40O8 |
| Molecular Weight: | 552.66 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Euphorbia pekinensis Rupr. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(O[C@H]1[C@@H](C)C[C@]2([C@H]1[C@H](OC(=O)C)[C@@]1(CC[C@H]3[C@@H](/C=C(/C2=O)C)C3(C)C)CO1)OC(=O)C)Cc1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Euphorbiasteroid is a tricyclic diperpene of Euphorbia lathyris L., inhibits tyrosinase, and increases the phosphorylation of AMPK, with anti-cancer, anti-virus, anti-obesity and multidrug resistance-modulating effect[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 633.1±55.0 °C at 760 mmHg |
| Flash Point | 263.9±31.5 °C |
| Exact Mass | 552.272339 |
| PSA | 108.50000 |
| LogP | 5.55 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |