Home
Products
Isoanhydroicaritin
| Product Name | Isoanhydroicaritin |
| Price: | Inquiry |
| Catalog No.: | CN04823 |
| CAS No.: | 28610-30-2 |
| Molecular Formula: | C21H20O6 |
| Molecular Weight: | 368.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Epimedium brevicornu Maxim |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c2c(c1CC=C(C)C)oc(c(c2=O)O)c1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isoanhydroicaritin is a flavonoid isolated from the dried root of S. flavescens[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 610.4±55.0 °C at 760 mmHg |
| Flash Point | 217.9±25.0 °C |
| Exact Mass | 368.125977 |
| PSA | 100.13000 |
| LogP | 4.65 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Storage condition | 2-8°C |