Home
Products
Orientin
| Product Name | Orientin |
| Price: | $69 / 20mg |
| Catalog No.: | CN05434 |
| CAS No.: | 28608-75-5 |
| Molecular Formula: | C21H20O11 |
| Molecular Weight: | 448.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Polygonum orientale Linn. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)c1c(O)cc(c2c1oc(cc2=O)c1ccc(c(c1)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Orientin is a naturally occurring bioactive flavonoid that possesses diverse biological properties, including anti-inflammation, anti-oxidative, anti-tumor, and cardio protection. Orientin is a promising neuroprotective agent suitable for therapy for neuropathic pain[1][2]. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 816.1±65.0 °C at 760 mmHg |
| Flash Point | 289.1±27.8 °C |
| Exact Mass | 448.100555 |
| PSA | 201.28000 |
| LogP | 1.58 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Storage condition | 2~8°C |