Home
Products
Persicogenin
| Product Name | Persicogenin |
| Price: | $263 / 10mg |
| Catalog No.: | CN04654 |
| CAS No.: | 28590-40-1 |
| Molecular Formula: | C17H16O6 |
| Molecular Weight: | 316.30 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The flowers of Chromolaena odorata. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2O[C@@H](CC(=O)c2c(c1)O)c1ccc(c(c1)O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Persicogenin, isolated from Rhus retinorrhoea, possesses anti-cancer activity[1]. |
| Density | 1.358g/cm3 |
| Boiling Point | 574.9ºC at 760 mmHg |
| Flash Point | 215ºC |
| Exact Mass | 316.09500 |
| PSA | 85.22000 |
| LogP | 2.82150 |
| Vapour Pressure | 8.12E-14mmHg at 25°C |